About cyclobutanecarboxylic acid;hydrofluoride
cyclobutanecarboxylic acid;hydrofluoride (PubChem CID 161438543) has the molecular formula C5H9FO2
and a molecular weight of 120.12 g/mol. Its IUPAC name is cyclobutanecarboxylic acid;hydrofluoride.
Molecular Properties
| Compound Name | cyclobutanecarboxylic acid;hydrofluoride |
| PubChem CID | 161438543 |
| Molecular Formula | C5H9FO2 |
| Molecular Weight | 120.12 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | cyclobutanecarboxylic acid;hydrofluoride |
| SMILES | F.O=C(O)C1CCC1 |
| InChI | InChI=1S/C5H8O2.FH/c6-5(7)4-2-1-3-4;/h4H,1-3H2,(H,6,7);1H |
| InChIKey | DNCBPPCMUIURJL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.12 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclobutanecarboxylic acid;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutanecarboxylic acid;hydrofluoride?
The IUPAC name of cyclobutanecarboxylic acid;hydrofluoride (CID 161438543) is cyclobutanecarboxylic acid;hydrofluoride.
What is the SMILES notation for cyclobutanecarboxylic acid;hydrofluoride?
The canonical SMILES for cyclobutanecarboxylic acid;hydrofluoride is F.O=C(O)C1CCC1.
What is the InChIKey of cyclobutanecarboxylic acid;hydrofluoride?
The InChIKey is DNCBPPCMUIURJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.FH/c6-5(7)4-2-1-3-4;/h4H,1-3H2,(H,6,7);1H.
What are the key properties of cyclobutanecarboxylic acid;hydrofluoride?
cyclobutanecarboxylic acid;hydrofluoride has a molecular weight of 120.12 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutanecarboxylic acid;hydrofluoride is sourced from PubChem (CID 161438543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).