C9H16O2 — CID 161441050
(2R,6S)-4,4,6-trimethyl-5-methylideneoxan-2-ol (PubChem CID 161441050) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (2R,6S)-4,4,6-trimethyl-5-methylideneoxan-2-ol.
| Compound Name | (2R,6S)-4,4,6-trimethyl-5-methylideneoxan-2-ol |
|---|---|
| PubChem CID | 161441050 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2R,6S)-4,4,6-trimethyl-5-methylideneoxan-2-ol |
| SMILES | C=C1[C@H](C)O[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C9H16O2/c1-6-7(2)11-8(10)5-9(6,3)4/h7-8,10H,1,5H2,2-4H3/t7-,8+/m0/s1 |
| InChIKey | VZGWNHNHIGSHJB-JGVFFNPUSA-N |
| XLogP | 1.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|