C20H38O6S2 — CID 161442143
3-acetyloxybutan-2-yl acetate;propan-2-yl acetate;2,2,4,5-tetramethyl-1,3-dithiolane (PubChem CID 161442143) has the molecular formula C20H38O6S2 and a molecular weight of 438.65 g/mol. Its IUPAC name is 3-acetyloxybutan-2-yl acetate;propan-2-yl acetate;2,2,4,5-tetramethyl-1,3-dithiolane.
| Compound Name | 3-acetyloxybutan-2-yl acetate;propan-2-yl acetate;2,2,4,5-tetramethyl-1,3-dithiolane |
|---|---|
| PubChem CID | 161442143 |
| Molecular Formula | C20H38O6S2 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3-acetyloxybutan-2-yl acetate;propan-2-yl acetate;2,2,4,5-tetramethyl-1,3-dithiolane |
| SMILES | CC(=O)OC(C)C.CC(=O)OC(C)C(C)OC(C)=O.CC1SC(C)(C)SC1C |
| InChI | InChI=1S/C8H14O4.C7H14S2.C5H10O2/c1-5(11-7(3)9)6(2)12-8(4)10;1-5-6(2)9-7(3,4)8-5;1-4(2)7-5(3)6/h5-6H,1-4H3;5-6H,1-4H3;4H,1-3H3 |
| InChIKey | VZKLTIAWSCNZMQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|