C30H50O8P4 — CID 161443565
5,5-dimethyl-2-[[2,4,5-tris[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)methyl]phenyl]methyl]-1,3,2-dioxaphosphinane (PubChem CID 161443565) has the molecular formula C30H50O8P4 and a molecular weight of 662.62 g/mol. Its IUPAC name is 5,5-dimethyl-2-[[2,4,5-tris[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)methyl]phenyl]methyl]-1,3,2-dioxaphosphinane.
| Compound Name | 5,5-dimethyl-2-[[2,4,5-tris[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)methyl]phenyl]methyl]-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 161443565 |
| Molecular Formula | C30H50O8P4 |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 5,5-dimethyl-2-[[2,4,5-tris[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)methyl]phenyl]methyl]-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)COP(Cc2cc(CP3OCC(C)(C)CO3)c(CP3OCC(C)(C)CO3)cc2CP2OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C30H50O8P4/c1-27(2)15-31-39(32-16-27)11-23-9-25(13-41-35-19-29(5,6)20-36-41)26(14-42-37-21-30(7,8)22-38-42)10-24(23)12-40-33-17-28(3,4)18-34-40/h9-10H,11-22H2,1-8H3 |
| InChIKey | VZPJEBIPKBVKNW-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|