About CID 161445098
CID 161445098 (PubChem CID 161445098) has the molecular formula C20H40BNO5P2
and a molecular weight of 447.30 g/mol.
Molecular Properties
| Compound Name | CID 161445098 |
| PubChem CID | 161445098 |
| Molecular Formula | C20H40BNO5P2 |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@@](/C=C/P(C)(C)=O)(CC)CC(OP(OCCC)N(C(C)C)C(C)C)[C@H]1O |
| InChI | InChI=1S/C20H40BNO5P2/c1-9-12-25-28(22(15(3)4)16(5)6)27-17-14-20(10-2,11-13-29(7,8)24)26-19(21)18(17)23/h11,13,15-19,23H,9-10,12,14H2,1-8H3/b13-11+/t17?,18-,19-,20-,28?/m1/s1 |
| InChIKey | VLOXDZVNLRQHHT-DJDMDDPNSA-N |
| XLogP | 4.70 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 161445098 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161445098?
The IUPAC name of CID 161445098 (CID 161445098) is not available.
What is the SMILES notation for CID 161445098?
The canonical SMILES for CID 161445098 is [B][C@@H]1O[C@@](/C=C/P(C)(C)=O)(CC)CC(OP(OCCC)N(C(C)C)C(C)C)[C@H]1O.
What is the InChIKey of CID 161445098?
The InChIKey is VLOXDZVNLRQHHT-DJDMDDPNSA-N. The full InChI is InChI=1S/C20H40BNO5P2/c1-9-12-25-28(22(15(3)4)16(5)6)27-17-14-20(10-2,11-13-29(7,8)24)26-19(21)18(17)23/h11,13,15-19,23H,9-10,12,14H2,1-8H3/b13-11+/t17?,18-,19-,20-,28?/m1/s1.
What are the key properties of CID 161445098?
CID 161445098 has a molecular weight of 447.30 g/mol, XLogP of 4.70, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161445098 is sourced from PubChem (CID 161445098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).