About 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole
3,4-dimethyl-1-methylidene-1,2,5-thiadiazole (PubChem CID 161447004) has the molecular formula C5H8N2S
and a molecular weight of 128.20 g/mol. Its IUPAC name is 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole |
| PubChem CID | 161447004 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole |
| SMILES | C=S1N=C(C)C(C)=N1 |
| InChI | InChI=1S/C5H8N2S/c1-4-5(2)7-8(3)6-4/h3H2,1-2H3 |
| InChIKey | WQAHBJNSUPKOTD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole?
The IUPAC name of 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole (CID 161447004) is 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole.
What is the SMILES notation for 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole?
The canonical SMILES for 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole is C=S1N=C(C)C(C)=N1.
What is the InChIKey of 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole?
The InChIKey is WQAHBJNSUPKOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S/c1-4-5(2)7-8(3)6-4/h3H2,1-2H3.
What are the key properties of 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole?
3,4-dimethyl-1-methylidene-1,2,5-thiadiazole has a molecular weight of 128.20 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-methylidene-1,2,5-thiadiazole is sourced from PubChem (CID 161447004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).