C42H38Cl2N8O6 — CID 161447187
benzyl 3-[[(6-chloropyrimidin-4-yl)-methylcarbamoyl]amino]-4-methylbenzoate;benzyl 3-isocyanato-4-methylbenzoate;6-chloro-N-methylpyrimidin-4-amine (PubChem CID 161447187) has the molecular formula C42H38Cl2N8O6 and a molecular weight of 821.72 g/mol. Its IUPAC name is benzyl 3-[[(6-chloropyrimidin-4-yl)-methylcarbamoyl]amino]-4-methylbenzoate;benzyl 3-isocyanato-4-methylbenzoate;6-chloro-N-methylpyrimidin-4-amine.
| Compound Name | benzyl 3-[[(6-chloropyrimidin-4-yl)-methylcarbamoyl]amino]-4-methylbenzoate;benzyl 3-isocyanato-4-methylbenzoate;6-chloro-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 161447187 |
| Molecular Formula | C42H38Cl2N8O6 |
| Molecular Weight | 821.72 g/mol |
| Exact Mass | 820.23 |
| IUPAC Name | benzyl 3-[[(6-chloropyrimidin-4-yl)-methylcarbamoyl]amino]-4-methylbenzoate;benzyl 3-isocyanato-4-methylbenzoate;6-chloro-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(Cl)ncn1.Cc1ccc(C(=O)OCc2ccccc2)cc1N=C=O.Cc1ccc(C(=O)OCc2ccccc2)cc1NC(=O)N(C)c1cc(Cl)ncn1 |
| InChI | InChI=1S/C21H19ClN4O3.C16H13NO3.C5H6ClN3/c1-14-8-9-16(20(27)29-12-15-6-4-3-5-7-15)10-17(14)25-21(28)26(2)19-11-18(22)23-13-24-19;1-12-7-8-14(9-15(12)17-11-18)16(19)20-10-13-5-3-2-4-6-13;1-7-5-2-4(6)8-3-9-5/h3-11,13H,12H2,1-2H3,(H,25,28);2-9H,10H2,1H3;2-3H,1H3,(H,7,8,9) |
| InChIKey | WAAXZVOAUNXZHZ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 177.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.72 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|