About 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol
3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol (PubChem CID 161447348) has the molecular formula C15H12BF2NO4
and a molecular weight of 319.07 g/mol. Its IUPAC name is 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol.
Molecular Properties
| Compound Name | 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol |
| PubChem CID | 161447348 |
| Molecular Formula | C15H12BF2NO4 |
| Molecular Weight | 319.07 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol |
| SMILES | Cc1cc(C(O)=CC=C2C=CC=C2)c(OB(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12BF2NO4/c1-10-8-12(14(20)7-6-11-4-2-3-5-11)15(23-16(17)18)13(9-10)19(21)22/h2-9,20H,1H3 |
| InChIKey | FHCTXJCYYSSACU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.07 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol?
The IUPAC name of 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol (CID 161447348) is 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol.
What is the SMILES notation for 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol?
The canonical SMILES for 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol is Cc1cc(C(O)=CC=C2C=CC=C2)c(OB(F)F)c([N+](=O)[O-])c1.
What is the InChIKey of 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol?
The InChIKey is FHCTXJCYYSSACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BF2NO4/c1-10-8-12(14(20)7-6-11-4-2-3-5-11)15(23-16(17)18)13(9-10)19(21)22/h2-9,20H,1H3.
What are the key properties of 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol?
3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol has a molecular weight of 319.07 g/mol, XLogP of 4.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-2,4-dien-1-ylidene-1-(2-difluoroboranyloxy-5-methyl-3-nitrophenyl)prop-1-en-1-ol is sourced from PubChem (CID 161447348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).