C29H41N3O5S — CID 161448560
tert-butyl N-[(1S,4R,6S,7Z,14S)-2,15-dioxo-4-(thiophen-2-ylmethylcarbamoyl)-16-azatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 161448560) has the molecular formula C29H41N3O5S and a molecular weight of 543.73 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,7Z,14S)-2,15-dioxo-4-(thiophen-2-ylmethylcarbamoyl)-16-azatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,7Z,14S)-2,15-dioxo-4-(thiophen-2-ylmethylcarbamoyl)-16-azatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 161448560 |
| Molecular Formula | C29H41N3O5S |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,7Z,14S)-2,15-dioxo-4-(thiophen-2-ylmethylcarbamoyl)-16-azatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NCc2cccs2)CC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C29H41N3O5S/c1-28(2,3)37-27(36)31-22-13-8-6-4-5-7-11-20-17-29(20,26(35)30-19-21-12-10-16-38-21)18-24(33)23-14-9-15-32(23)25(22)34/h7,10-12,16,20,22-23H,4-6,8-9,13-15,17-19H2,1-3H3,(H,30,35)(H,31,36)/b11-7-/t20-,22+,23+,29-/m1/s1 |
| InChIKey | WAFIFCSJZOUINT-WXVRITKFSA-N |
| XLogP | 4.73 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|