About 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane
1,2-bis(2-isocyanatopropan-2-yl)benzene;propane (PubChem CID 161448729) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane.
Molecular Properties
| Compound Name | 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane |
| PubChem CID | 161448729 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane |
| SMILES | CC(C)(N=C=O)c1ccccc1C(C)(C)N=C=O.CCC |
| InChI | InChI=1S/C14H16N2O2.C3H8/c1-13(2,15-9-17)11-7-5-6-8-12(11)14(3,4)16-10-18;1-3-2/h5-8H,1-4H3;3H2,1-2H3 |
| InChIKey | WAFWGEZCUMPXCK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane?
The IUPAC name of 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane (CID 161448729) is 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane.
What is the SMILES notation for 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane?
The canonical SMILES for 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane is CC(C)(N=C=O)c1ccccc1C(C)(C)N=C=O.CCC.
What is the InChIKey of 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane?
The InChIKey is WAFWGEZCUMPXCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2.C3H8/c1-13(2,15-9-17)11-7-5-6-8-12(11)14(3,4)16-10-18;1-3-2/h5-8H,1-4H3;3H2,1-2H3.
What are the key properties of 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane?
1,2-bis(2-isocyanatopropan-2-yl)benzene;propane has a molecular weight of 288.39 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(2-isocyanatopropan-2-yl)benzene;propane is sourced from PubChem (CID 161448729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).