About [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol
[3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol (PubChem CID 161452102) has the molecular formula C13H18O7
and a molecular weight of 286.28 g/mol. Its IUPAC name is [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol.
Molecular Properties
| Compound Name | [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol |
| PubChem CID | 161452102 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol |
| SMILES | COc1ccc(OC)c2c1COC(C(O)O)(C(O)O)C2 |
| InChI | InChI=1S/C13H18O7/c1-18-9-3-4-10(19-2)8-6-20-13(11(14)15,12(16)17)5-7(8)9/h3-4,11-12,14-17H,5-6H2,1-2H3 |
| InChIKey | WAQXHWDOQJZIQE-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol?
The IUPAC name of [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol (CID 161452102) is [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol.
What is the SMILES notation for [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol?
The canonical SMILES for [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol is COc1ccc(OC)c2c1COC(C(O)O)(C(O)O)C2.
What is the InChIKey of [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol?
The InChIKey is WAQXHWDOQJZIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O7/c1-18-9-3-4-10(19-2)8-6-20-13(11(14)15,12(16)17)5-7(8)9/h3-4,11-12,14-17H,5-6H2,1-2H3.
What are the key properties of [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol?
[3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol has a molecular weight of 286.28 g/mol, XLogP of -0.86, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dihydroxymethyl)-5,8-dimethoxy-1,4-dihydroisochromen-3-yl]methanediol is sourced from PubChem (CID 161452102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).