C28H40O6P2 — CID 161452701
(2S)-2,5,7,8-tetramethyl-6-phosphanyloxy-3,4-dihydrochromene-2-carbaldehyde;[(2S)-2,5,7,8-tetramethyl-6-phosphanyloxy-3,4-dihydrochromen-2-yl]methanol (PubChem CID 161452701) has the molecular formula C28H40O6P2 and a molecular weight of 534.57 g/mol. Its IUPAC name is (2S)-2,5,7,8-tetramethyl-6-phosphanyloxy-3,4-dihydrochromene-2-carbaldehyde;[(2S)-2,5,7,8-tetramethyl-6-phosphanyloxy-3,4-dihydrochromen-2-yl]methanol.
| Compound Name | (2S)-2,5,7,8-tetramethyl-6-phosphanyloxy-3,4-dihydrochromene-2-carbaldehyde;[(2S)-2,5,7,8-tetramethyl-6-phosphanyloxy-3,4-dihydrochromen-2-yl]methanol |
|---|---|
| PubChem CID | 161452701 |
| Molecular Formula | C28H40O6P2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (2S)-2,5,7,8-tetramethyl-6-phosphanyloxy-3,4-dihydrochromene-2-carbaldehyde;[(2S)-2,5,7,8-tetramethyl-6-phosphanyloxy-3,4-dihydrochromen-2-yl]methanol |
| SMILES | Cc1c(C)c2c(c(C)c1OP)CC[C@@](C)(C=O)O2.Cc1c(C)c2c(c(C)c1OP)CC[C@@](C)(CO)O2 |
| InChI | InChI=1S/C14H21O3P.C14H19O3P/c2*1-8-9(2)13-11(10(3)12(8)17-18)5-6-14(4,7-15)16-13/h15H,5-7,18H2,1-4H3;7H,5-6,18H2,1-4H3/t2*14-/m00/s1 |
| InChIKey | WASYMMRFGWJHEL-DXZWIFNPSA-N |
| XLogP | 5.92 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|