C28H38FN4O8P — CID 161453278
hexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 161453278) has the molecular formula C28H38FN4O8P and a molecular weight of 608.60 g/mol. Its IUPAC name is hexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | hexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 161453278 |
| Molecular Formula | C28H38FN4O8P |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | hexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCCCOC(=O)[C@H](C)N[P@](=O)(OC[C@@]1(CF)O[C@@H](c2ccc3c(N)ccnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C28H38FN4O8P/c1-3-4-5-9-16-38-27(36)19(2)32-42(37,41-20-10-7-6-8-11-20)39-18-28(17-29)26(35)24(34)25(40-28)23-13-12-22-21(30)14-15-31-33(22)23/h6-8,10-15,19,24-26,34-35H,3-5,9,16-18,30H2,1-2H3,(H,32,37)/t19-,24-,25-,26-,28+,42-/m0/s1 |
| InChIKey | RSXOQQYMEPVVOG-LYXMYFBLSA-N |
| XLogP | 3.72 |
| TPSA | 166.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|