About 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde
4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde (PubChem CID 161454151) has the molecular formula C14H9F2IO2
and a molecular weight of 374.12 g/mol. Its IUPAC name is 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde.
Molecular Properties
| Compound Name | 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde |
| PubChem CID | 161454151 |
| Molecular Formula | C14H9F2IO2 |
| Molecular Weight | 374.12 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde |
| SMILES | O=Cc1ccc(F)c(I)c1.O=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C7H4FIO.C7H5FO/c8-6-2-1-5(4-10)3-7(6)9;8-7-3-1-6(5-9)2-4-7/h1-4H;1-5H |
| InChIKey | WAXUTIIHGJWVIJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.12 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde?
The IUPAC name of 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde (CID 161454151) is 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde.
What is the SMILES notation for 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde?
The canonical SMILES for 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde is O=Cc1ccc(F)c(I)c1.O=Cc1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde?
The InChIKey is WAXUTIIHGJWVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FIO.C7H5FO/c8-6-2-1-5(4-10)3-7(6)9;8-7-3-1-6(5-9)2-4-7/h1-4H;1-5H.
What are the key properties of 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde?
4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde has a molecular weight of 374.12 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzaldehyde;4-fluoro-3-iodobenzaldehyde is sourced from PubChem (CID 161454151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).