C19H29N7O2 — CID 161454598
2,5-dimethyl-1H-imidazole;3,5-dimethyl-1,2,4-oxadiazole;2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1H-pyrazole (PubChem CID 161454598) has the molecular formula C19H29N7O2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;3,5-dimethyl-1,2,4-oxadiazole;2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1H-pyrazole.
| Compound Name | 2,5-dimethyl-1H-imidazole;3,5-dimethyl-1,2,4-oxadiazole;2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 161454598 |
| Molecular Formula | C19H29N7O2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;3,5-dimethyl-1,2,4-oxadiazole;2,5-dimethyl-1,3-oxazole;3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1cc(C)[nH]n1.Cc1cnc(C)[nH]1.Cc1cnc(C)o1.Cc1noc(C)n1 |
| InChI | InChI=1S/2C5H8N2.C5H7NO.C4H6N2O/c1-4-3-6-5(2)7-4;1-4-3-5(2)7-6-4;1-4-3-6-5(2)7-4;1-3-5-4(2)7-6-3/h2*3H,1-2H3,(H,6,7);3H,1-2H3;1-2H3 |
| InChIKey | WAZHLRJTACIEOJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |