C19H28F3N3O6S — CID 161454891
1-[5-[(2R)-4-methyl-2-[5-(2,2,2-trifluoroethoxy)-1,2-oxazol-3-yl]pentyl]sulfonylpentyl]imidazolidine-2,4-dione (PubChem CID 161454891) has the molecular formula C19H28F3N3O6S and a molecular weight of 483.51 g/mol. Its IUPAC name is 1-[5-[(2R)-4-methyl-2-[5-(2,2,2-trifluoroethoxy)-1,2-oxazol-3-yl]pentyl]sulfonylpentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[(2R)-4-methyl-2-[5-(2,2,2-trifluoroethoxy)-1,2-oxazol-3-yl]pentyl]sulfonylpentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 161454891 |
| Molecular Formula | C19H28F3N3O6S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 1-[5-[(2R)-4-methyl-2-[5-(2,2,2-trifluoroethoxy)-1,2-oxazol-3-yl]pentyl]sulfonylpentyl]imidazolidine-2,4-dione |
| SMILES | CC(C)C[C@@H](CS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1cc(OCC(F)(F)F)on1 |
| InChI | InChI=1S/C19H28F3N3O6S/c1-13(2)8-14(15-9-17(31-24-15)30-12-19(20,21)22)11-32(28,29)7-5-3-4-6-25-10-16(26)23-18(25)27/h9,13-14H,3-8,10-12H2,1-2H3,(H,23,26,27)/t14-/m0/s1 |
| InChIKey | WBAGKXNONHDGFY-AWEZNQCLSA-N |
| XLogP | 2.88 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|