About benzene;1-benzofuran;methane
benzene;1-benzofuran;methane (PubChem CID 161455380) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is benzene;1-benzofuran;methane.
Molecular Properties
| Compound Name | benzene;1-benzofuran;methane |
| PubChem CID | 161455380 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | benzene;1-benzofuran;methane |
| SMILES | C.c1ccc2occc2c1.c1ccccc1 |
| InChI | InChI=1S/C8H6O.C6H6.CH4/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-6-5-3-1;/h1-6H;1-6H;1H4 |
| InChIKey | WBBWGEACKGOHRR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;1-benzofuran;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-benzofuran;methane?
The IUPAC name of benzene;1-benzofuran;methane (CID 161455380) is benzene;1-benzofuran;methane.
What is the SMILES notation for benzene;1-benzofuran;methane?
The canonical SMILES for benzene;1-benzofuran;methane is C.c1ccc2occc2c1.c1ccccc1.
What is the InChIKey of benzene;1-benzofuran;methane?
The InChIKey is WBBWGEACKGOHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C6H6.CH4/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-6-5-3-1;/h1-6H;1-6H;1H4.
What are the key properties of benzene;1-benzofuran;methane?
benzene;1-benzofuran;methane has a molecular weight of 212.29 g/mol, XLogP of 4.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-benzofuran;methane is sourced from PubChem (CID 161455380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).