C18H26N2O4 — CID 161456445
2-amino-3-(2-hydroxyethyl)-6-methylphenol;5-(2-hydroxyethylamino)-2-methylphenol (PubChem CID 161456445) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-amino-3-(2-hydroxyethyl)-6-methylphenol;5-(2-hydroxyethylamino)-2-methylphenol.
| Compound Name | 2-amino-3-(2-hydroxyethyl)-6-methylphenol;5-(2-hydroxyethylamino)-2-methylphenol |
|---|---|
| PubChem CID | 161456445 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-amino-3-(2-hydroxyethyl)-6-methylphenol;5-(2-hydroxyethylamino)-2-methylphenol |
| SMILES | Cc1ccc(CCO)c(N)c1O.Cc1ccc(NCCO)cc1O |
| InChI | InChI=1S/2C9H13NO2/c1-7-2-3-8(6-9(7)12)10-4-5-11;1-6-2-3-7(4-5-11)8(10)9(6)12/h2-3,6,10-12H,4-5H2,1H3;2-3,11-12H,4-5,10H2,1H3 |
| InChIKey | WBFHTZHGSDIPFM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|