C33H40ClFN8O — CID 161456570
6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-3-[4-[6-[(1,2,3,6-tetrahydropyrazin-5-ylamino)methyl]piperidin-2-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 161456570) has the molecular formula C33H40ClFN8O and a molecular weight of 619.19 g/mol. Its IUPAC name is 6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-3-[4-[6-[(1,2,3,6-tetrahydropyrazin-5-ylamino)methyl]piperidin-2-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-3-[4-[6-[(1,2,3,6-tetrahydropyrazin-5-ylamino)methyl]piperidin-2-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 161456570 |
| Molecular Formula | C33H40ClFN8O |
| Molecular Weight | 619.19 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-3-[4-[6-[(1,2,3,6-tetrahydropyrazin-5-ylamino)methyl]piperidin-2-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | CC(N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(C5CCCC(CNC6=NCCNC6)N5)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C33H40ClFN8O/c1-20(36)4-2-5-21-14-26(31(35)27(34)15-21)29-16-23-19-43(33(44)42-32(23)41-29)25-10-8-22(9-11-25)28-7-3-6-24(40-28)17-39-30-18-37-12-13-38-30/h8-11,14-16,19-20,24,28,37,40H,2-7,12-13,17-18,36H2,1H3,(H,38,39)(H,41,42,44) |
| InChIKey | WBFQCNNESATVSX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.19 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |