C38H79N5 — CID 161457537
N'-ethyl-N-methyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;1,2,2,4,6,6-hexamethylpiperidine (PubChem CID 161457537) has the molecular formula C38H79N5 and a molecular weight of 606.09 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;1,2,2,4,6,6-hexamethylpiperidine.
| Compound Name | N'-ethyl-N-methyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;1,2,2,4,6,6-hexamethylpiperidine |
|---|---|
| PubChem CID | 161457537 |
| Molecular Formula | C38H79N5 |
| Molecular Weight | 606.09 g/mol |
| Exact Mass | 605.63 |
| IUPAC Name | N'-ethyl-N-methyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;1,2,2,4,6,6-hexamethylpiperidine |
| SMILES | CC1CC(C)(C)N(C)C(C)(C)C1.CCN(CCCCCCN(C)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H56N4.C11H23N/c1-11-31(23-20-26(6,7)29-27(8,9)21-23)17-15-13-12-14-16-30(10)22-18-24(2,3)28-25(4,5)19-22;1-9-7-10(2,3)12(6)11(4,5)8-9/h22-23,28-29H,11-21H2,1-10H3;9H,7-8H2,1-6H3 |
| InChIKey | WBIXYTORCAMDDB-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.09 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|