C48H84 — CID 161457679
1,2,3,4,5,6,7,8-octamethylnaphthalene;1,2,3,4-tetramethylcyclohexane;1,2,3,5-tetramethylcyclohexane;1,2,4,5-tetramethylcyclohexane (PubChem CID 161457679) has the molecular formula C48H84 and a molecular weight of 661.20 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octamethylnaphthalene;1,2,3,4-tetramethylcyclohexane;1,2,3,5-tetramethylcyclohexane;1,2,4,5-tetramethylcyclohexane.
| Compound Name | 1,2,3,4,5,6,7,8-octamethylnaphthalene;1,2,3,4-tetramethylcyclohexane;1,2,3,5-tetramethylcyclohexane;1,2,4,5-tetramethylcyclohexane |
|---|---|
| PubChem CID | 161457679 |
| Molecular Formula | C48H84 |
| Molecular Weight | 661.20 g/mol |
| Exact Mass | 660.66 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octamethylnaphthalene;1,2,3,4-tetramethylcyclohexane;1,2,3,5-tetramethylcyclohexane;1,2,4,5-tetramethylcyclohexane |
| SMILES | CC1CC(C)C(C)C(C)C1.CC1CC(C)C(C)CC1C.CC1CCC(C)C(C)C1C.Cc1c(C)c(C)c2c(C)c(C)c(C)c(C)c2c1C |
| InChI | InChI=1S/C18H24.3C10H20/c1-9-10(2)14(6)18-16(8)12(4)11(3)15(7)17(18)13(9)5;1-7-5-9(3)10(4)6-8(7)2;1-7-5-8(2)10(4)9(3)6-7;1-7-5-6-8(2)10(4)9(7)3/h1-8H3;3*7-10H,5-6H2,1-4H3 |
| InChIKey | WBJITCUHDSFIRO-UHFFFAOYSA-N |
| XLogP | 15.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.20 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |