About 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one
1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one (PubChem CID 161458664) has the molecular formula C25H20F2N4O2
and a molecular weight of 446.46 g/mol. Its IUPAC name is 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one.
Molecular Properties
| Compound Name | 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one |
| PubChem CID | 161458664 |
| Molecular Formula | C25H20F2N4O2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one |
| SMILES | COc1cc(-c2cc(F)ccc2F)cc2c(N3CCCC(=O)C3)nc(-c3cccnc3)nc12 |
| InChI | InChI=1S/C25H20F2N4O2/c1-33-22-11-16(19-12-17(26)6-7-21(19)27)10-20-23(22)29-24(15-4-2-8-28-13-15)30-25(20)31-9-3-5-18(32)14-31/h2,4,6-8,10-13H,3,5,9,14H2,1H3 |
| InChIKey | WBMSSAIOHMNYAA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one?
The IUPAC name of 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one (CID 161458664) is 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one.
What is the SMILES notation for 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one?
The canonical SMILES for 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one is COc1cc(-c2cc(F)ccc2F)cc2c(N3CCCC(=O)C3)nc(-c3cccnc3)nc12.
What is the InChIKey of 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one?
The InChIKey is WBMSSAIOHMNYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20F2N4O2/c1-33-22-11-16(19-12-17(26)6-7-21(19)27)10-20-23(22)29-24(15-4-2-8-28-13-15)30-25(20)31-9-3-5-18(32)14-31/h2,4,6-8,10-13H,3,5,9,14H2,1H3.
What are the key properties of 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one?
1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one has a molecular weight of 446.46 g/mol, XLogP of 4.81, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2,5-difluorophenyl)-8-methoxy-2-pyridin-3-ylquinazolin-4-yl]piperidin-3-one is sourced from PubChem (CID 161458664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).