C27H34Br2N4 — CID 161458758
4,5-dibromo-1-pentyl-2-[2-(1-pentylbenzimidazol-2-yl)propan-2-yl]benzimidazole (PubChem CID 161458758) has the molecular formula C27H34Br2N4 and a molecular weight of 574.41 g/mol. Its IUPAC name is 4,5-dibromo-1-pentyl-2-[2-(1-pentylbenzimidazol-2-yl)propan-2-yl]benzimidazole.
| Compound Name | 4,5-dibromo-1-pentyl-2-[2-(1-pentylbenzimidazol-2-yl)propan-2-yl]benzimidazole |
|---|---|
| PubChem CID | 161458758 |
| Molecular Formula | C27H34Br2N4 |
| Molecular Weight | 574.41 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 4,5-dibromo-1-pentyl-2-[2-(1-pentylbenzimidazol-2-yl)propan-2-yl]benzimidazole |
| SMILES | CCCCCn1c(C(C)(C)c2nc3c(Br)c(Br)ccc3n2CCCCC)nc2ccccc21 |
| InChI | InChI=1S/C27H34Br2N4/c1-5-7-11-17-32-21-14-10-9-13-20(21)30-25(32)27(3,4)26-31-24-22(16-15-19(28)23(24)29)33(26)18-12-8-6-2/h9-10,13-16H,5-8,11-12,17-18H2,1-4H3 |
| InChIKey | RSEFFUXLCLAMCL-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.41 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|