About CID 161459011
CID 161459011 (PubChem CID 161459011) has the molecular formula C51H41B2BrN12O5
and a molecular weight of 1003.50 g/mol.
Molecular Properties
| Compound Name | CID 161459011 |
| PubChem CID | 161459011 |
| Molecular Formula | C51H41B2BrN12O5 |
| Molecular Weight | 1003.50 g/mol |
| Exact Mass | 1002.27 |
| IUPAC Name | — |
| SMILES | COCc1cccc2[nH]c(-c3nn(C)c4ncc(-c5cncc6ccccc56)cc34)nc12.OB(O)c1cncc2ccccc12.[B]C(=O)n1c(-c2nn(C)c3ncc(Br)cc23)nc2c(COC)cccc21 |
| InChI | InChI=1S/C25H20N6O.C17H13BBrN5O2.C9H8BNO2/c1-31-25-19(10-17(12-27-25)20-13-26-11-15-6-3-4-8-18(15)20)23(30-31)24-28-21-9-5-7-16(14-32-2)22(21)29-24;1-23-15-11(6-10(19)7-20-15)14(22-23)16-21-13-9(8-26-2)4-3-5-12(13)24(16)17(18)25;12-10(13)9-6-11-5-7-3-1-2-4-8(7)9/h3-13H,14H2,1-2H3,(H,28,29);3-7H,8H2,1-2H3;1-6,12-13H |
| InChIKey | RUGIFYXXECGHPO-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 209.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1003.50 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 161459011 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161459011?
The IUPAC name of CID 161459011 (CID 161459011) is not available.
What is the SMILES notation for CID 161459011?
The canonical SMILES for CID 161459011 is COCc1cccc2[nH]c(-c3nn(C)c4ncc(-c5cncc6ccccc56)cc34)nc12.OB(O)c1cncc2ccccc12.[B]C(=O)n1c(-c2nn(C)c3ncc(Br)cc23)nc2c(COC)cccc21.
What is the InChIKey of CID 161459011?
The InChIKey is RUGIFYXXECGHPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N6O.C17H13BBrN5O2.C9H8BNO2/c1-31-25-19(10-17(12-27-25)20-13-26-11-15-6-3-4-8-18(15)20)23(30-31)24-28-21-9-5-7-16(14-32-2)22(21)29-24;1-23-15-11(6-10(19)7-20-15)14(22-23)16-21-13-9(8-26-2)4-3-5-12(13)24(16)17(18)25;12-10(13)9-6-11-5-7-3-1-2-4-8(7)9/h3-13H,14H2,1-2H3,(H,28,29);3-7H,8H2,1-2H3;1-6,12-13H.
What are the key properties of CID 161459011?
CID 161459011 has a molecular weight of 1003.50 g/mol, XLogP of 7.82, 8 rotatable bonds, 3 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161459011 is sourced from PubChem (CID 161459011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).