C9H14FNO3 — CID 161460548
1-fluoro-6-(hydroxymethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 161460548) has the molecular formula C9H14FNO3 and a molecular weight of 203.21 g/mol. Its IUPAC name is 1-fluoro-6-(hydroxymethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | 1-fluoro-6-(hydroxymethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 161460548 |
| Molecular Formula | C9H14FNO3 |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 1-fluoro-6-(hydroxymethyl)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OC(F)C2CC(CO)C(=O)N21 |
| InChI | InChI=1S/C9H14FNO3/c1-9(2)11-6(7(10)14-9)3-5(4-12)8(11)13/h5-7,12H,3-4H2,1-2H3 |
| InChIKey | WBSYUFJWBPXNOD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |