C28H30N6O — CID 161460746
1-[(2R)-2-(isocyanomethyl)-4-[8-(8-methylnaphthalen-1-yl)-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 161460746) has the molecular formula C28H30N6O and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-[(2R)-2-(isocyanomethyl)-4-[8-(8-methylnaphthalen-1-yl)-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-2-(isocyanomethyl)-4-[8-(8-methylnaphthalen-1-yl)-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 161460746 |
| Molecular Formula | C28H30N6O |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-[(2R)-2-(isocyanomethyl)-4-[8-(8-methylnaphthalen-1-yl)-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]C[C@H]1CN(c2ncnc3c2CCCN(c2cccc4cccc(C)c24)C3)CCN1C(=O)C=C |
| InChI | InChI=1S/C28H30N6O/c1-4-26(35)34-15-14-33(17-22(34)16-29-3)28-23-11-7-13-32(18-24(23)30-19-31-28)25-12-6-10-21-9-5-8-20(2)27(21)25/h4-6,8-10,12,19,22H,1,7,11,13-18H2,2H3/t22-/m0/s1 |
| InChIKey | GKNUMPKANDMUSM-QFIPXVFZSA-N |
| XLogP | 4.01 |
| TPSA | 56.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|