C24H48N8O2 — CID 161465016
3,4,4-trimethyl-1-propan-2-yl-6-propan-2-ylimino-1,3,5-triazinan-2-one (PubChem CID 161465016) has the molecular formula C24H48N8O2 and a molecular weight of 480.70 g/mol. Its IUPAC name is 3,4,4-trimethyl-1-propan-2-yl-6-propan-2-ylimino-1,3,5-triazinan-2-one.
| Compound Name | 3,4,4-trimethyl-1-propan-2-yl-6-propan-2-ylimino-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 161465016 |
| Molecular Formula | C24H48N8O2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | 3,4,4-trimethyl-1-propan-2-yl-6-propan-2-ylimino-1,3,5-triazinan-2-one |
| SMILES | CC(C)/N=C1\NC(C)(C)N(C)C(=O)N1C(C)C.CC(C)/N=C1\NC(C)(C)N(C)C(=O)N1C(C)C |
| InChI | InChI=1S/2C12H24N4O/c2*1-8(2)13-10-14-12(5,6)15(7)11(17)16(10)9(3)4/h2*8-9H,1-7H3,(H,13,14) |
| InChIKey | WCHRWLRIMIXFRS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|