C24H35N — CID 161465437
4-[(10R,13S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methylbut-3-en-2-imine (PubChem CID 161465437) has the molecular formula C24H35N and a molecular weight of 337.55 g/mol. Its IUPAC name is 4-[(10R,13S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methylbut-3-en-2-imine.
| Compound Name | 4-[(10R,13S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methylbut-3-en-2-imine |
|---|---|
| PubChem CID | 161465437 |
| Molecular Formula | C24H35N |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | 4-[(10R,13S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methylbut-3-en-2-imine |
| SMILES | [H]/N=C(\C)C(C)=CC1=CCC2C3CC=C4CCCC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C24H35N/c1-16(17(2)25)15-19-9-11-21-20-10-8-18-7-5-6-13-23(18,3)22(20)12-14-24(19,21)4/h8-9,15,20-22,25H,5-7,10-14H2,1-4H3/b16-15?,25-17+/t20?,21?,22?,23-,24+/m0/s1 |
| InChIKey | PNNSWNXUWCPNQO-RPPDYOFNSA-N |
| XLogP | 6.86 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|