C10H24N2O — CID 161466003
2-methylpropan-1-amine;N-(2-methylpropyl)acetamide (PubChem CID 161466003) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-methylpropan-1-amine;N-(2-methylpropyl)acetamide.
| Compound Name | 2-methylpropan-1-amine;N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 161466003 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | 2-methylpropan-1-amine;N-(2-methylpropyl)acetamide |
| SMILES | CC(=O)NCC(C)C.CC(C)CN |
| InChI | InChI=1S/C6H13NO.C4H11N/c1-5(2)4-7-6(3)8;1-4(2)3-5/h5H,4H2,1-3H3,(H,7,8);4H,3,5H2,1-2H3 |
| InChIKey | WCLFAKGIUBBSEW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |