C22H21Cl5N2O7 — CID 161466042
methyl 3-carbonochloridoyl-2,6-dichloro-N-methoxybenzenecarboximidate;methyl 2,4-dichloro-3-(propoxycarbamoyl)benzoate (PubChem CID 161466042) has the molecular formula C22H21Cl5N2O7 and a molecular weight of 602.68 g/mol. Its IUPAC name is methyl 3-carbonochloridoyl-2,6-dichloro-N-methoxybenzenecarboximidate;methyl 2,4-dichloro-3-(propoxycarbamoyl)benzoate.
| Compound Name | methyl 3-carbonochloridoyl-2,6-dichloro-N-methoxybenzenecarboximidate;methyl 2,4-dichloro-3-(propoxycarbamoyl)benzoate |
|---|---|
| PubChem CID | 161466042 |
| Molecular Formula | C22H21Cl5N2O7 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 599.98 |
| IUPAC Name | methyl 3-carbonochloridoyl-2,6-dichloro-N-methoxybenzenecarboximidate;methyl 2,4-dichloro-3-(propoxycarbamoyl)benzoate |
| SMILES | CCCONC(=O)c1c(Cl)ccc(C(=O)OC)c1Cl.CON=C(OC)c1c(Cl)ccc(C(=O)Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl2NO4.C10H8Cl3NO3/c1-3-6-19-15-11(16)9-8(13)5-4-7(10(9)14)12(17)18-2;1-16-10(14-17-2)7-6(11)4-3-5(8(7)12)9(13)15/h4-5H,3,6H2,1-2H3,(H,15,16);3-4H,1-2H3 |
| InChIKey | WCLHHTYRWCQLQL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|