C26H30 — CID 161468262
tetracyclo[6.2.1.13,6.02,7]dodec-4-ene;tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,12-tetraene (PubChem CID 161468262) has the molecular formula C26H30 and a molecular weight of 342.53 g/mol. Its IUPAC name is tetracyclo[6.2.1.13,6.02,7]dodec-4-ene;tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,12-tetraene.
| Compound Name | tetracyclo[6.2.1.13,6.02,7]dodec-4-ene;tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,12-tetraene |
|---|---|
| PubChem CID | 161468262 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | tetracyclo[6.2.1.13,6.02,7]dodec-4-ene;tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,12-tetraene |
| SMILES | C1=CC2CC1C1C3CCC(C3)C21.C1=CC2CC1C1Cc3ccccc3C21 |
| InChI | InChI=1S/C14H14.C12H16/c1-2-4-12-9(3-1)8-13-10-5-6-11(7-10)14(12)13;1-2-8-5-7(1)11-9-3-4-10(6-9)12(8)11/h1-6,10-11,13-14H,7-8H2;1-2,7-12H,3-6H2 |
| InChIKey | WCSMDFKJAGMNKZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|