About hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine
hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine (PubChem CID 161469949) has the molecular formula C8H10N3O4PS
and a molecular weight of 275.23 g/mol. Its IUPAC name is hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 161469949 |
| Molecular Formula | C8H10N3O4PS |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccccc2)s1.O=[P+]([O-])OO.[H][H] |
| InChI | InChI=1S/C8H7N3S.HO4P.H2/c9-8-11-10-7(12-8)6-4-2-1-3-5-6;1-4-5(2)3;/h1-5H,(H2,9,11);1H;1H |
| InChIKey | WCYFFPRMCNXXHQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine (CID 161469949) is hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine is Nc1nnc(-c2ccccc2)s1.O=[P+]([O-])OO.[H][H].
What is the InChIKey of hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine?
The InChIKey is WCYFFPRMCNXXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3S.HO4P.H2/c9-8-11-10-7(12-8)6-4-2-1-3-5-6;1-4-5(2)3;/h1-5H,(H2,9,11);1H;1H.
What are the key properties of hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine?
hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine has a molecular weight of 275.23 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for hydroperoxy-oxido-oxophosphanium;molecular hydrogen;5-phenyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 161469949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).