About 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene
1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene (PubChem CID 161471768) has the molecular formula C18H18N4O5S2
and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene.
Molecular Properties
| Compound Name | 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene |
| PubChem CID | 161471768 |
| Molecular Formula | C18H18N4O5S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene |
| SMILES | CC(=O)C(=[N+]=[N-])S(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)C=[N+]=[N-])cc1 |
| InChI | InChI=1S/C10H10N2O3S.C8H8N2O2S/c1-7-3-5-9(6-4-7)16(14,15)10(12-11)8(2)13;1-7-2-4-8(5-3-7)13(11,12)6-10-9/h3-6H,1-2H3;2-6H,1H3 |
| InChIKey | WDEKTVZTISXZJO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 158.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene?
The IUPAC name of 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene (CID 161471768) is 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene.
What is the SMILES notation for 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene?
The canonical SMILES for 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene is CC(=O)C(=[N+]=[N-])S(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)C=[N+]=[N-])cc1.
What is the InChIKey of 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene?
The InChIKey is WDEKTVZTISXZJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3S.C8H8N2O2S/c1-7-3-5-9(6-4-7)16(14,15)10(12-11)8(2)13;1-7-2-4-8(5-3-7)13(11,12)6-10-9/h3-6H,1-2H3;2-6H,1H3.
What are the key properties of 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene?
1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene has a molecular weight of 434.50 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-1-(4-methylphenyl)sulfonylpropan-2-one;1-(diazomethylsulfonyl)-4-methylbenzene is sourced from PubChem (CID 161471768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).