C31H39BN2O3 — CID 161471780
1-(oxan-2-yl)-5-[(Z)-1-[4-[(E)-prop-1-enyl]phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]indazole (PubChem CID 161471780) has the molecular formula C31H39BN2O3 and a molecular weight of 498.48 g/mol. Its IUPAC name is 1-(oxan-2-yl)-5-[(Z)-1-[4-[(E)-prop-1-enyl]phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]indazole.
| Compound Name | 1-(oxan-2-yl)-5-[(Z)-1-[4-[(E)-prop-1-enyl]phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]indazole |
|---|---|
| PubChem CID | 161471780 |
| Molecular Formula | C31H39BN2O3 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 1-(oxan-2-yl)-5-[(Z)-1-[4-[(E)-prop-1-enyl]phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]indazole |
| SMILES | C/C=C/c1ccc(/C(=C(/CC)B2OC(C)(C)C(C)(C)O2)c2ccc3c(cnn3C3CCCCO3)c2)cc1 |
| InChI | InChI=1S/C31H39BN2O3/c1-7-11-22-13-15-23(16-14-22)29(26(8-2)32-36-30(3,4)31(5,6)37-32)24-17-18-27-25(20-24)21-33-34(27)28-12-9-10-19-35-28/h7,11,13-18,20-21,28H,8-10,12,19H2,1-6H3/b11-7+,29-26+ |
| InChIKey | PMDICSQVTMLXOH-BHUOOIMVSA-N |
| XLogP | 7.61 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|