C17H20N2O — CID 161471913
(7-ethynyl-4,5-dihydro-1H-inden-2-yl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 161471913) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (7-ethynyl-4,5-dihydro-1H-inden-2-yl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | (7-ethynyl-4,5-dihydro-1H-inden-2-yl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 161471913 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (7-ethynyl-4,5-dihydro-1H-inden-2-yl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | C#CC1=CCCC2=C1CC(C(=O)N1CCN(C)CC1)=C2 |
| InChI | InChI=1S/C17H20N2O/c1-3-13-5-4-6-14-11-15(12-16(13)14)17(20)19-9-7-18(2)8-10-19/h1,5,11H,4,6-10,12H2,2H3 |
| InChIKey | WDEXRZMEKJIOBP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|