About CID 161472503
CID 161472503 (PubChem CID 161472503) has the molecular formula C29H43AlClN4O
and a molecular weight of 526.13 g/mol.
Molecular Properties
| Compound Name | CID 161472503 |
| PubChem CID | 161472503 |
| Molecular Formula | C29H43AlClN4O |
| Molecular Weight | 526.13 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | — |
| SMILES | CC(C)C[Al]CC(C)C.CCC(C)c1ccc(Cl)c2nc3n(c12)CCCN3c1ccc(OC)nc1C |
| InChI | InChI=1S/C21H25ClN4O.2C4H9.Al/c1-5-13(2)15-7-8-16(22)19-20(15)26-12-6-11-25(21(26)24-19)17-9-10-18(27-4)23-14(17)3;2*1-4(2)3;/h7-10,13H,5-6,11-12H2,1-4H3;2*4H,1H2,2-3H3; |
| InChIKey | BDFCXGUELGBGSC-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.13 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 161472503 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161472503?
The IUPAC name of CID 161472503 (CID 161472503) is not available.
What is the SMILES notation for CID 161472503?
The canonical SMILES for CID 161472503 is CC(C)C[Al]CC(C)C.CCC(C)c1ccc(Cl)c2nc3n(c12)CCCN3c1ccc(OC)nc1C.
What is the InChIKey of CID 161472503?
The InChIKey is BDFCXGUELGBGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25ClN4O.2C4H9.Al/c1-5-13(2)15-7-8-16(22)19-20(15)26-12-6-11-25(21(26)24-19)17-9-10-18(27-4)23-14(17)3;2*1-4(2)3;/h7-10,13H,5-6,11-12H2,1-4H3;2*4H,1H2,2-3H3;.
What are the key properties of CID 161472503?
CID 161472503 has a molecular weight of 526.13 g/mol, XLogP of 8.30, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161472503 is sourced from PubChem (CID 161472503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).