About 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane
6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane (PubChem CID 161473357) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane.
Molecular Properties
| Compound Name | 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane |
| PubChem CID | 161473357 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane |
| SMILES | C.CC(=O)c1cc(-c2c(C)cc(C)c(=O)n2C)nn1C |
| InChI | InChI=1S/C14H17N3O2.CH4/c1-8-6-9(2)14(19)16(4)13(8)11-7-12(10(3)18)17(5)15-11;/h6-7H,1-5H3;1H4 |
| InChIKey | WDJPQTSQJTYFHQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane?
The IUPAC name of 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane (CID 161473357) is 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane.
What is the SMILES notation for 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane?
The canonical SMILES for 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane is C.CC(=O)c1cc(-c2c(C)cc(C)c(=O)n2C)nn1C.
What is the InChIKey of 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane?
The InChIKey is WDJPQTSQJTYFHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2.CH4/c1-8-6-9(2)14(19)16(4)13(8)11-7-12(10(3)18)17(5)15-11;/h6-7H,1-5H3;1H4.
What are the key properties of 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane?
6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane has a molecular weight of 275.35 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-acetyl-1-methylpyrazol-3-yl)-1,3,5-trimethylpyridin-2-one;methane is sourced from PubChem (CID 161473357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).