About benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate
benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate (PubChem CID 161473770) has the molecular formula C18H22N2O3
and a molecular weight of 314.39 g/mol. Its IUPAC name is benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate.
Molecular Properties
| Compound Name | benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate |
| PubChem CID | 161473770 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate |
| SMILES | CN=C=O.CNC(=O)OC.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C3H7NO2.C2H3NO/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-4-3(5)6-2;1-3-2-4/h1-10H,11H2;1-2H3,(H,4,5);1H3 |
| InChIKey | WDKYTRKQQQGIKQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate?
The IUPAC name of benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate (CID 161473770) is benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate.
What is the SMILES notation for benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate?
The canonical SMILES for benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate is CN=C=O.CNC(=O)OC.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate?
The InChIKey is WDKYTRKQQQGIKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C3H7NO2.C2H3NO/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-4-3(5)6-2;1-3-2-4/h1-10H,11H2;1-2H3,(H,4,5);1H3.
What are the key properties of benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate?
benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate has a molecular weight of 314.39 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;methylimino(oxo)methane;methyl N-methylcarbamate is sourced from PubChem (CID 161473770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).