C16H19N3O3S — CID 161473935
(3S)-N-hydroxy-3-methyl-4-pyridin-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide;sulfane (PubChem CID 161473935) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is (3S)-N-hydroxy-3-methyl-4-pyridin-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide;sulfane.
| Compound Name | (3S)-N-hydroxy-3-methyl-4-pyridin-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide;sulfane |
|---|---|
| PubChem CID | 161473935 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (3S)-N-hydroxy-3-methyl-4-pyridin-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide;sulfane |
| SMILES | C[C@H]1COc2cc(C(=O)NO)ccc2CN1c1ccccn1.S |
| InChI | InChI=1S/C16H17N3O3.H2S/c1-11-10-22-14-8-12(16(20)18-21)5-6-13(14)9-19(11)15-4-2-3-7-17-15;/h2-8,11,21H,9-10H2,1H3,(H,18,20);1H2/t11-;/m0./s1 |
| InChIKey | WDLPYPZHELZAJY-MERQFXBCSA-N |
| XLogP | 2.10 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|