C26H46BaO6 — CID 161474430
barium(2+);(Z)-4-butoxy-4-oxobut-2-enoate;octadecanoate (PubChem CID 161474430) has the molecular formula C26H46BaO6 and a molecular weight of 591.98 g/mol. Its IUPAC name is barium(2+);(Z)-4-butoxy-4-oxobut-2-enoate;octadecanoate.
| Compound Name | barium(2+);(Z)-4-butoxy-4-oxobut-2-enoate;octadecanoate |
|---|---|
| PubChem CID | 161474430 |
| Molecular Formula | C26H46BaO6 |
| Molecular Weight | 591.98 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | barium(2+);(Z)-4-butoxy-4-oxobut-2-enoate;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCOC(=O)/C=C\C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/C18H36O2.C8H12O4.Ba/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-6-12-8(11)5-4-7(9)10;/h2-17H2,1H3,(H,19,20);4-5H,2-3,6H2,1H3,(H,9,10);/q;;+2/p-2/b;5-4-; |
| InChIKey | WDNGFILXWGFXJU-FXHNQCOHSA-L |
| XLogP | 4.25 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.98 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|