C33H45F2NO6SSi — CID 161476811
5-[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methyl-3-(2-trimethylsilylethoxymethoxy)cyclobutyl]oxolan-2-one (PubChem CID 161476811) has the molecular formula C33H45F2NO6SSi and a molecular weight of 649.87 g/mol. Its IUPAC name is 5-[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methyl-3-(2-trimethylsilylethoxymethoxy)cyclobutyl]oxolan-2-one.
| Compound Name | 5-[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methyl-3-(2-trimethylsilylethoxymethoxy)cyclobutyl]oxolan-2-one |
|---|---|
| PubChem CID | 161476811 |
| Molecular Formula | C33H45F2NO6SSi |
| Molecular Weight | 649.87 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 5-[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methyl-3-(2-trimethylsilylethoxymethoxy)cyclobutyl]oxolan-2-one |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1cc(F)c(C2(C3CCC(=O)O3)CC(C)(OCOCC[Si](C)(C)C)C2)cc1F |
| InChI | InChI=1S/C33H45F2NO6SSi/c1-23-11-12-29(24-9-7-6-8-10-24)43(38,39)36(23)19-25-17-28(35)26(18-27(25)34)33(30-13-14-31(37)42-30)20-32(2,21-33)41-22-40-15-16-44(3,4)5/h6-10,17-18,23,29-30H,11-16,19-22H2,1-5H3/t23-,29+,30?,32?,33?/m0/s1 |
| InChIKey | ZDGBVOLFYIMDCF-HVLGGUEQSA-N |
| XLogP | 6.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.87 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|