About diazoniosulfonylcyclohexane;1-methylsulfonyldecane
diazoniosulfonylcyclohexane;1-methylsulfonyldecane (PubChem CID 161477553) has the molecular formula C17H35N2O4S2+
and a molecular weight of 395.61 g/mol. Its IUPAC name is diazoniosulfonylcyclohexane;1-methylsulfonyldecane.
Molecular Properties
| Compound Name | diazoniosulfonylcyclohexane;1-methylsulfonyldecane |
| PubChem CID | 161477553 |
| Molecular Formula | C17H35N2O4S2+ |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | diazoniosulfonylcyclohexane;1-methylsulfonyldecane |
| SMILES | CCCCCCCCCCS(C)(=O)=O.N#[N+]S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H24O2S.C6H11N2O2S/c1-3-4-5-6-7-8-9-10-11-14(2,12)13;7-8-11(9,10)6-4-2-1-3-5-6/h3-11H2,1-2H3;6H,1-5H2/q;+1 |
| InChIKey | WDXKTLQZFLOWLQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 96.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze diazoniosulfonylcyclohexane;1-methylsulfonyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazoniosulfonylcyclohexane;1-methylsulfonyldecane?
The IUPAC name of diazoniosulfonylcyclohexane;1-methylsulfonyldecane (CID 161477553) is diazoniosulfonylcyclohexane;1-methylsulfonyldecane.
What is the SMILES notation for diazoniosulfonylcyclohexane;1-methylsulfonyldecane?
The canonical SMILES for diazoniosulfonylcyclohexane;1-methylsulfonyldecane is CCCCCCCCCCS(C)(=O)=O.N#[N+]S(=O)(=O)C1CCCCC1.
What is the InChIKey of diazoniosulfonylcyclohexane;1-methylsulfonyldecane?
The InChIKey is WDXKTLQZFLOWLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2S.C6H11N2O2S/c1-3-4-5-6-7-8-9-10-11-14(2,12)13;7-8-11(9,10)6-4-2-1-3-5-6/h3-11H2,1-2H3;6H,1-5H2/q;+1.
What are the key properties of diazoniosulfonylcyclohexane;1-methylsulfonyldecane?
diazoniosulfonylcyclohexane;1-methylsulfonyldecane has a molecular weight of 395.61 g/mol, XLogP of 4.67, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diazoniosulfonylcyclohexane;1-methylsulfonyldecane is sourced from PubChem (CID 161477553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).