C9H7F6N3O — CID 161477900
3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbonitrile (PubChem CID 161477900) has the molecular formula C9H7F6N3O and a molecular weight of 287.16 g/mol. Its IUPAC name is 3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbonitrile.
| Compound Name | 3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 161477900 |
| Molecular Formula | C9H7F6N3O |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbonitrile |
| SMILES | Cc1c(OC(F)(F)C(F)C(F)(F)F)nn(C)c1C#N |
| InChI | InChI=1S/C9H7F6N3O/c1-4-5(3-16)18(2)17-6(4)19-9(14,15)7(10)8(11,12)13/h7H,1-2H3 |
| InChIKey | UMXDDANCGKTODO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |