C24H27BClF3N2O3 — CID 161480420
2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]acetamide (PubChem CID 161480420) has the molecular formula C24H27BClF3N2O3 and a molecular weight of 494.75 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]acetamide |
|---|---|
| PubChem CID | 161480420 |
| Molecular Formula | C24H27BClF3N2O3 |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]acetamide |
| SMILES | CC1(C)OB(c2ccc(NC(C(=O)NC3CC(F)(F)C3)c3ccccc3Cl)cc2F)OC1(C)C |
| InChI | InChI=1S/C24H27BClF3N2O3/c1-22(2)23(3,4)34-25(33-22)17-10-9-14(11-19(17)27)30-20(16-7-5-6-8-18(16)26)21(32)31-15-12-24(28,29)13-15/h5-11,15,20,30H,12-13H2,1-4H3,(H,31,32) |
| InChIKey | XDQVXNRIFPFGDT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|