C20H27Cl3N4O2S2 — CID 161480728
[3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-(2,3,6-trichlorophenyl)pyrazin-2-yl]methanol;sulfane (PubChem CID 161480728) has the molecular formula C20H27Cl3N4O2S2 and a molecular weight of 525.96 g/mol. Its IUPAC name is [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-(2,3,6-trichlorophenyl)pyrazin-2-yl]methanol;sulfane.
| Compound Name | [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-(2,3,6-trichlorophenyl)pyrazin-2-yl]methanol;sulfane |
|---|---|
| PubChem CID | 161480728 |
| Molecular Formula | C20H27Cl3N4O2S2 |
| Molecular Weight | 525.96 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | [3-[(3S,4S)-4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-6-(2,3,6-trichlorophenyl)pyrazin-2-yl]methanol;sulfane |
| SMILES | C[C@@H]1OCC2(CCN(c3ncc(-c4c(Cl)ccc(Cl)c4Cl)nc3CO)CC2)[C@@H]1N.S.S |
| InChI | InChI=1S/C20H23Cl3N4O2.2H2S/c1-11-18(24)20(10-29-11)4-6-27(7-5-20)19-15(9-28)26-14(8-25-19)16-12(21)2-3-13(22)17(16)23;;/h2-3,8,11,18,28H,4-7,9-10,24H2,1H3;2*1H2/t11-,18+;;/m0../s1 |
| InChIKey | WEHXHVVCRWNCRP-QECCAMSCSA-N |
| XLogP | 4.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.96 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|