About 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal
3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal (PubChem CID 161481541) has the molecular formula C10H18O6
and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal |
| PubChem CID | 161481541 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal |
| SMILES | COCC(=O)C(OC)C(CO)C(C=O)OC |
| InChI | InChI=1S/C10H18O6/c1-14-6-8(13)10(16-3)7(4-11)9(5-12)15-2/h5,7,9-11H,4,6H2,1-3H3 |
| InChIKey | XSODZZRIQXFZFW-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal?
The IUPAC name of 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal (CID 161481541) is 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal.
What is the SMILES notation for 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal?
The canonical SMILES for 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal is COCC(=O)C(OC)C(CO)C(C=O)OC.
What is the InChIKey of 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal?
The InChIKey is XSODZZRIQXFZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O6/c1-14-6-8(13)10(16-3)7(4-11)9(5-12)15-2/h5,7,9-11H,4,6H2,1-3H3.
What are the key properties of 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal?
3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal has a molecular weight of 234.25 g/mol, XLogP of -0.96, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-2,4,6-trimethoxy-5-oxohexanal is sourced from PubChem (CID 161481541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).