About 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane
2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane (PubChem CID 161482780) has the molecular formula C23H46N4
and a molecular weight of 378.65 g/mol. Its IUPAC name is 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 161482780 |
| Molecular Formula | C23H46N4 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 378.37 |
| IUPAC Name | 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane |
| SMILES | CC(C)(C)N1CCC2(CCNC2)C1.CN1CCC2(CCN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C12H24N2.C11H22N2/c1-11(2,3)14-8-6-12(10-14)5-7-13(4)9-12;1-10(2,3)13-7-5-11(9-13)4-6-12-8-11/h5-10H2,1-4H3;12H,4-9H2,1-3H3 |
| InChIKey | WEOVCTCLUOPQJZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane (CID 161482780) is 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane is CC(C)(C)N1CCC2(CCNC2)C1.CN1CCC2(CCN(C(C)(C)C)C2)C1.
What is the InChIKey of 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane?
The InChIKey is WEOVCTCLUOPQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.C11H22N2/c1-11(2,3)14-8-6-12(10-14)5-7-13(4)9-12;1-10(2,3)13-7-5-11(9-13)4-6-12-8-11/h5-10H2,1-4H3;12H,4-9H2,1-3H3.
What are the key properties of 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane?
2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane has a molecular weight of 378.65 g/mol, XLogP of 3.28, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,7-diazaspiro[4.4]nonane;2-tert-butyl-7-methyl-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 161482780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).