C30H24Cl2N4O3 — CID 161484433
2-benzoyl-7-chloro-3,4-dihydro-2,6-naphthyridin-1-one;(7-chloro-3,4-dihydro-1H-2,6-naphthyridin-2-yl)-phenylmethanone (PubChem CID 161484433) has the molecular formula C30H24Cl2N4O3 and a molecular weight of 559.45 g/mol. Its IUPAC name is 2-benzoyl-7-chloro-3,4-dihydro-2,6-naphthyridin-1-one;(7-chloro-3,4-dihydro-1H-2,6-naphthyridin-2-yl)-phenylmethanone.
| Compound Name | 2-benzoyl-7-chloro-3,4-dihydro-2,6-naphthyridin-1-one;(7-chloro-3,4-dihydro-1H-2,6-naphthyridin-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 161484433 |
| Molecular Formula | C30H24Cl2N4O3 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 2-benzoyl-7-chloro-3,4-dihydro-2,6-naphthyridin-1-one;(7-chloro-3,4-dihydro-1H-2,6-naphthyridin-2-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCc2cnc(Cl)cc2C1.O=C(c1ccccc1)N1CCc2cnc(Cl)cc2C1=O |
| InChI | InChI=1S/C15H11ClN2O2.C15H13ClN2O/c16-13-8-12-11(9-17-13)6-7-18(15(12)20)14(19)10-4-2-1-3-5-10;16-14-8-13-10-18(7-6-12(13)9-17-14)15(19)11-4-2-1-3-5-11/h1-5,8-9H,6-7H2;1-5,8-9H,6-7,10H2 |
| InChIKey | WEUDPSRTQNRRDT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|