About 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate
1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate (PubChem CID 161484609) has the molecular formula C20H18Br3F4IO4
and a molecular weight of 764.97 g/mol. Its IUPAC name is 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate |
| PubChem CID | 161484609 |
| Molecular Formula | C20H18Br3F4IO4 |
| Molecular Weight | 764.97 g/mol |
| Exact Mass | 761.77 |
| IUPAC Name | 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate |
| SMILES | Brc1ccc(I)cc1.CCOC(=O)C(F)(F)Br.CCOC(=O)C(F)(F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H9BrF2O2.C6H4BrI.C4H5BrF2O2/c1-2-15-9(14)10(12,13)7-3-5-8(11)6-4-7;7-5-1-3-6(8)4-2-5;1-2-9-3(8)4(5,6)7/h3-6H,2H2,1H3;1-4H;2H2,1H3 |
| InChIKey | WEUSRGBMACVAAZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 764.97 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate?
The IUPAC name of 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate (CID 161484609) is 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate.
What is the SMILES notation for 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate?
The canonical SMILES for 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate is Brc1ccc(I)cc1.CCOC(=O)C(F)(F)Br.CCOC(=O)C(F)(F)c1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate?
The InChIKey is WEUSRGBMACVAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2O2.C6H4BrI.C4H5BrF2O2/c1-2-15-9(14)10(12,13)7-3-5-8(11)6-4-7;7-5-1-3-6(8)4-2-5;1-2-9-3(8)4(5,6)7/h3-6H,2H2,1H3;1-4H;2H2,1H3.
What are the key properties of 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate?
1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate has a molecular weight of 764.97 g/mol, XLogP of 7.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-iodobenzene;ethyl 2-bromo-2,2-difluoroacetate;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate is sourced from PubChem (CID 161484609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).