C12H16 — CID 161485173
3,4-dimethyl-1,1b,2,3,5a,6-hexahydrocyclopropa[a]indene (PubChem CID 161485173) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 3,4-dimethyl-1,1b,2,3,5a,6-hexahydrocyclopropa[a]indene.
| Compound Name | 3,4-dimethyl-1,1b,2,3,5a,6-hexahydrocyclopropa[a]indene |
|---|---|
| PubChem CID | 161485173 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 3,4-dimethyl-1,1b,2,3,5a,6-hexahydrocyclopropa[a]indene |
| SMILES | CC1=CC2CC3=C(C3)C2CC1C |
| InChI | InChI=1S/C12H16/c1-7-3-9-5-10-6-12(10)11(9)4-8(7)2/h3,8-9,11H,4-6H2,1-2H3 |
| InChIKey | WEWQBRPNPRYNPL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|